About N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine
N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine (PubChem CID 62280357) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine |
| PubChem CID | 62280357 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cc(N2CCCN(C)CC2)ccn1 |
| InChI | InChI=1S/C14H24N4/c1-3-15-12-13-11-14(5-6-16-13)18-8-4-7-17(2)9-10-18/h5-6,11,15H,3-4,7-10,12H2,1-2H3 |
| InChIKey | UABNZTOEHQDMRW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine?
The IUPAC name of N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine (CID 62280357) is N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine.
What is the SMILES notation for N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine?
The canonical SMILES for N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine is CCNCc1cc(N2CCCN(C)CC2)ccn1.
What is the InChIKey of N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine?
The InChIKey is UABNZTOEHQDMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4/c1-3-15-12-13-11-14(5-6-16-13)18-8-4-7-17(2)9-10-18/h5-6,11,15H,3-4,7-10,12H2,1-2H3.
What are the key properties of N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine?
N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine has a molecular weight of 248.37 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methyl]ethanamine is sourced from PubChem (CID 62280357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).