C10H17N3 — CID 62280400
N-ethyl-N-methyl-5-(methylaminomethyl)pyridin-2-amine (PubChem CID 62280400) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N-ethyl-N-methyl-5-(methylaminomethyl)pyridin-2-amine.
| Compound Name | N-ethyl-N-methyl-5-(methylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62280400 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N-ethyl-N-methyl-5-(methylaminomethyl)pyridin-2-amine |
| SMILES | CCN(C)c1ccc(CNC)cn1 |
| InChI | InChI=1S/C10H17N3/c1-4-13(3)10-6-5-9(7-11-2)8-12-10/h5-6,8,11H,4,7H2,1-3H3 |
| InChIKey | QNGXUVLOVQHHEF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |