C11H18N4S — CID 62280602
N-methyl-6-(methylaminomethyl)-N-(thiolan-3-yl)pyridazin-3-amine (PubChem CID 62280602) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is N-methyl-6-(methylaminomethyl)-N-(thiolan-3-yl)pyridazin-3-amine.
| Compound Name | N-methyl-6-(methylaminomethyl)-N-(thiolan-3-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 62280602 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-methyl-6-(methylaminomethyl)-N-(thiolan-3-yl)pyridazin-3-amine |
| SMILES | CNCc1ccc(N(C)C2CCSC2)nn1 |
| InChI | InChI=1S/C11H18N4S/c1-12-7-9-3-4-11(14-13-9)15(2)10-5-6-16-8-10/h3-4,10,12H,5-8H2,1-2H3 |
| InChIKey | XFQWHXNJWMOYSI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |