C13H20ClN3S — CID 62280716
N-[(5-chloro-6-thiomorpholin-4-yl-3-pyridinyl)methyl]propan-2-amine (PubChem CID 62280716) has the molecular formula C13H20ClN3S and a molecular weight of 285.84 g/mol. Its IUPAC name is N-[(5-chloro-6-thiomorpholin-4-yl-3-pyridinyl)methyl]propan-2-amine.
| Compound Name | N-[(5-chloro-6-thiomorpholin-4-yl-3-pyridinyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 62280716 |
| Molecular Formula | C13H20ClN3S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[(5-chloro-6-thiomorpholin-4-yl-3-pyridinyl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cnc(N2CCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClN3S/c1-10(2)15-8-11-7-12(14)13(16-9-11)17-3-5-18-6-4-17/h7,9-10,15H,3-6,8H2,1-2H3 |
| InChIKey | YZZMPLRGXJNZLM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |