C15H24N4O — CID 62281484
6-[(cyclopropylamino)methyl]-N-methyl-N-(oxan-2-ylmethyl)pyridazin-3-amine (PubChem CID 62281484) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-[(cyclopropylamino)methyl]-N-methyl-N-(oxan-2-ylmethyl)pyridazin-3-amine.
| Compound Name | 6-[(cyclopropylamino)methyl]-N-methyl-N-(oxan-2-ylmethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 62281484 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 6-[(cyclopropylamino)methyl]-N-methyl-N-(oxan-2-ylmethyl)pyridazin-3-amine |
| SMILES | CN(CC1CCCCO1)c1ccc(CNC2CC2)nn1 |
| InChI | InChI=1S/C15H24N4O/c1-19(11-14-4-2-3-9-20-14)15-8-7-13(17-18-15)10-16-12-5-6-12/h7-8,12,14,16H,2-6,9-11H2,1H3 |
| InChIKey | QZRZEIDTPYXFOQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |