C16H21ClN4 — CID 62281535
3-chloro-N-methyl-5-[(propan-2-ylamino)methyl]-N-(pyridin-3-ylmethyl)pyridin-2-amine (PubChem CID 62281535) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is 3-chloro-N-methyl-5-[(propan-2-ylamino)methyl]-N-(pyridin-3-ylmethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-methyl-5-[(propan-2-ylamino)methyl]-N-(pyridin-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62281535 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-chloro-N-methyl-5-[(propan-2-ylamino)methyl]-N-(pyridin-3-ylmethyl)pyridin-2-amine |
| SMILES | CC(C)NCc1cnc(N(C)Cc2cccnc2)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4/c1-12(2)19-9-14-7-15(17)16(20-10-14)21(3)11-13-5-4-6-18-8-13/h4-8,10,12,19H,9,11H2,1-3H3 |
| InChIKey | IRJJLAATYQFRPV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |