C16H24ClN3 — CID 62282097
1-[6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chloro-3-pyridinyl]-N-methylmethanamine (PubChem CID 62282097) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is 1-[6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chloro-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chloro-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62282097 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-chloro-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnc(N2CCC3CCCCC3C2)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClN3/c1-18-9-12-8-15(17)16(19-10-12)20-7-6-13-4-2-3-5-14(13)11-20/h8,10,13-14,18H,2-7,9,11H2,1H3 |
| InChIKey | KBJDHYWIODCGSF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |