C16H28BrN3O — CID 62282182
5-bromo-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-[(propan-2-ylamino)methyl]pyridin-2-amine (PubChem CID 62282182) has the molecular formula C16H28BrN3O and a molecular weight of 358.32 g/mol. Its IUPAC name is 5-bromo-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-[(propan-2-ylamino)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-[(propan-2-ylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62282182 |
| Molecular Formula | C16H28BrN3O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 5-bromo-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-[(propan-2-ylamino)methyl]pyridin-2-amine |
| SMILES | COCCN(CC(C)C)c1ncc(Br)cc1CNC(C)C |
| InChI | InChI=1S/C16H28BrN3O/c1-12(2)11-20(6-7-21-5)16-14(9-18-13(3)4)8-15(17)10-19-16/h8,10,12-13,18H,6-7,9,11H2,1-5H3 |
| InChIKey | YQGMPQVGDRHKAC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |