C13H19F3N4 — CID 62284048
N-cyclopropyl-6-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridazin-3-amine (PubChem CID 62284048) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is N-cyclopropyl-6-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridazin-3-amine.
| Compound Name | N-cyclopropyl-6-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 62284048 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-cyclopropyl-6-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyridazin-3-amine |
| SMILES | CCCNCc1ccc(N(CC(F)(F)F)C2CC2)nn1 |
| InChI | InChI=1S/C13H19F3N4/c1-2-7-17-8-10-3-6-12(19-18-10)20(11-4-5-11)9-13(14,15)16/h3,6,11,17H,2,4-5,7-9H2,1H3 |
| InChIKey | YFUQXEKMNSFMHT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|