C14H24BrN3 — CID 62285020
3-(aminomethyl)-5-bromo-N-butan-2-yl-N-butylpyridin-2-amine (PubChem CID 62285020) has the molecular formula C14H24BrN3 and a molecular weight of 314.27 g/mol. Its IUPAC name is 3-(aminomethyl)-5-bromo-N-butan-2-yl-N-butylpyridin-2-amine.
| Compound Name | 3-(aminomethyl)-5-bromo-N-butan-2-yl-N-butylpyridin-2-amine |
|---|---|
| PubChem CID | 62285020 |
| Molecular Formula | C14H24BrN3 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-(aminomethyl)-5-bromo-N-butan-2-yl-N-butylpyridin-2-amine |
| SMILES | CCCCN(c1ncc(Br)cc1CN)C(C)CC |
| InChI | InChI=1S/C14H24BrN3/c1-4-6-7-18(11(3)5-2)14-12(9-16)8-13(15)10-17-14/h8,10-11H,4-7,9,16H2,1-3H3 |
| InChIKey | UVTJDXSXOSKYJG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |