About (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one
(3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one (PubChem CID 6228509) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one |
| PubChem CID | 6228509 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one |
| SMILES | COc1ccc(C(=O)/C=C2/C(=O)Nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C18H15NO4/c1-22-11-7-8-13(17(9-11)23-2)16(20)10-14-12-5-3-4-6-15(12)19-18(14)21/h3-10H,1-2H3,(H,19,21)/b14-10+ |
| InChIKey | LNUNRFUIERJJGH-GXDHUFHOSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one?
The IUPAC name of (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one (CID 6228509) is (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one.
What is the SMILES notation for (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one?
The canonical SMILES for (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one is COc1ccc(C(=O)/C=C2/C(=O)Nc3ccccc32)c(OC)c1.
What is the InChIKey of (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one?
The InChIKey is LNUNRFUIERJJGH-GXDHUFHOSA-N. The full InChI is InChI=1S/C18H15NO4/c1-22-11-7-8-13(17(9-11)23-2)16(20)10-14-12-5-3-4-6-15(12)19-18(14)21/h3-10H,1-2H3,(H,19,21)/b14-10+.
What are the key properties of (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one?
(3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one has a molecular weight of 309.32 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[2-(2,4-dimethoxyphenyl)-2-oxoethylidene]-1H-indol-2-one is sourced from PubChem (CID 6228509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).