About 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine
3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine (PubChem CID 62285737) has the molecular formula C17H21N3
and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine.
Molecular Properties
| Compound Name | 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine |
| PubChem CID | 62285737 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine |
| SMILES | C=CCN(CC=C)c1nc(CNC)cc2ccccc12 |
| InChI | InChI=1S/C17H21N3/c1-4-10-20(11-5-2)17-16-9-7-6-8-14(16)12-15(19-17)13-18-3/h4-9,12,18H,1-2,10-11,13H2,3H3 |
| InChIKey | VZOGXZYVPIBLAJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine?
The IUPAC name of 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine (CID 62285737) is 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine.
What is the SMILES notation for 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine?
The canonical SMILES for 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine is C=CCN(CC=C)c1nc(CNC)cc2ccccc12.
What is the InChIKey of 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine?
The InChIKey is VZOGXZYVPIBLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3/c1-4-10-20(11-5-2)17-16-9-7-6-8-14(16)12-15(19-17)13-18-3/h4-9,12,18H,1-2,10-11,13H2,3H3.
What are the key properties of 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine?
3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine has a molecular weight of 267.38 g/mol, XLogP of 3.13, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylaminomethyl)-N,N-bis(prop-2-enyl)isoquinolin-1-amine is sourced from PubChem (CID 62285737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).