About 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine
3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine (PubChem CID 62285753) has the molecular formula C14H25N3
and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine |
| PubChem CID | 62285753 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine |
| SMILES | CCN(CC)c1ncccc1CNC(C)(C)C |
| InChI | InChI=1S/C14H25N3/c1-6-17(7-2)13-12(9-8-10-15-13)11-16-14(3,4)5/h8-10,16H,6-7,11H2,1-5H3 |
| InChIKey | VYUBEVSCYYKBMA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine?
The IUPAC name of 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine (CID 62285753) is 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine.
What is the SMILES notation for 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine?
The canonical SMILES for 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine is CCN(CC)c1ncccc1CNC(C)(C)C.
What is the InChIKey of 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine?
The InChIKey is VYUBEVSCYYKBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3/c1-6-17(7-2)13-12(9-8-10-15-13)11-16-14(3,4)5/h8-10,16H,6-7,11H2,1-5H3.
What are the key properties of 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine?
3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine has a molecular weight of 235.37 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(tert-butylamino)methyl]-N,N-diethylpyridin-2-amine is sourced from PubChem (CID 62285753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).