C16H19Br2N3 — CID 62288203
5-bromo-N-[(4-bromophenyl)methyl]-3-(ethylaminomethyl)-N-methylpyridin-2-amine (PubChem CID 62288203) has the molecular formula C16H19Br2N3 and a molecular weight of 413.16 g/mol. Its IUPAC name is 5-bromo-N-[(4-bromophenyl)methyl]-3-(ethylaminomethyl)-N-methylpyridin-2-amine.
| Compound Name | 5-bromo-N-[(4-bromophenyl)methyl]-3-(ethylaminomethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 62288203 |
| Molecular Formula | C16H19Br2N3 |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 5-bromo-N-[(4-bromophenyl)methyl]-3-(ethylaminomethyl)-N-methylpyridin-2-amine |
| SMILES | CCNCc1cc(Br)cnc1N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H19Br2N3/c1-3-19-9-13-8-15(18)10-20-16(13)21(2)11-12-4-6-14(17)7-5-12/h4-8,10,19H,3,9,11H2,1-2H3 |
| InChIKey | OZTITARAHIOUEX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |