About [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine
[3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine (PubChem CID 62288804) has the molecular formula C12H15ClN4
and a molecular weight of 250.73 g/mol. Its IUPAC name is [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine |
| PubChem CID | 62288804 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine |
| SMILES | Cc1nn(-c2ccc(Cl)c(CN)n2)c(C)c1C |
| InChI | InChI=1S/C12H15ClN4/c1-7-8(2)16-17(9(7)3)12-5-4-10(13)11(6-14)15-12/h4-5H,6,14H2,1-3H3 |
| InChIKey | UJAWLUHGOHTZBU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine?
The IUPAC name of [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine (CID 62288804) is [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine.
What is the SMILES notation for [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine?
The canonical SMILES for [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine is Cc1nn(-c2ccc(Cl)c(CN)n2)c(C)c1C.
What is the InChIKey of [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine?
The InChIKey is UJAWLUHGOHTZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4/c1-7-8(2)16-17(9(7)3)12-5-4-10(13)11(6-14)15-12/h4-5H,6,14H2,1-3H3.
What are the key properties of [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine?
[3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine has a molecular weight of 250.73 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-6-(3,4,5-trimethylpyrazol-1-yl)-2-pyridinyl]methanamine is sourced from PubChem (CID 62288804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).