C10H16N2O — CID 62291375
N-[(4-methoxy-2-pyridinyl)methyl]propan-1-amine (PubChem CID 62291375) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[(4-methoxy-2-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(4-methoxy-2-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62291375 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[(4-methoxy-2-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(OC)ccn1 |
| InChI | InChI=1S/C10H16N2O/c1-3-5-11-8-9-7-10(13-2)4-6-12-9/h4,6-7,11H,3,5,8H2,1-2H3 |
| InChIKey | BAQMFOJXVAMGQH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|