C9H14N2O2 — CID 62292533
[4-(2-methoxyethoxy)-2-pyridinyl]methanamine (PubChem CID 62292533) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)-2-pyridinyl]methanamine.
| Compound Name | [4-(2-methoxyethoxy)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62292533 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | [4-(2-methoxyethoxy)-2-pyridinyl]methanamine |
| SMILES | COCCOc1ccnc(CN)c1 |
| InChI | InChI=1S/C9H14N2O2/c1-12-4-5-13-9-2-3-11-8(6-9)7-10/h2-3,6H,4-5,7,10H2,1H3 |
| InChIKey | OHQRDUIWOLUCOD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|