About N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine
N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 62293152) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 62293152 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cccc(N2CCOCC2(C)C)n1 |
| InChI | InChI=1S/C16H27N3O/c1-15(2,3)17-11-13-7-6-8-14(18-13)19-9-10-20-12-16(19,4)5/h6-8,17H,9-12H2,1-5H3 |
| InChIKey | XAKBUSJRFPGFDN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine (CID 62293152) is N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine is CC(C)(C)NCc1cccc(N2CCOCC2(C)C)n1.
What is the InChIKey of N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine?
The InChIKey is XAKBUSJRFPGFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O/c1-15(2,3)17-11-13-7-6-8-14(18-13)19-9-10-20-12-16(19,4)5/h6-8,17H,9-12H2,1-5H3.
What are the key properties of N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine?
N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine has a molecular weight of 277.41 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(3,3-dimethylmorpholin-4-yl)-2-pyridinyl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 62293152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).