About N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine
N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine (PubChem CID 62293226) has the molecular formula C12H16ClN5
and a molecular weight of 265.75 g/mol. Its IUPAC name is N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine |
| PubChem CID | 62293226 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine |
| SMILES | CCNCc1ccc(-n2nc(C)c(Cl)c2C)nn1 |
| InChI | InChI=1S/C12H16ClN5/c1-4-14-7-10-5-6-11(16-15-10)18-9(3)12(13)8(2)17-18/h5-6,14H,4,7H2,1-3H3 |
| InChIKey | WPSJYXMPHSCEKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine?
The IUPAC name of N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine (CID 62293226) is N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine.
What is the SMILES notation for N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine?
The canonical SMILES for N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine is CCNCc1ccc(-n2nc(C)c(Cl)c2C)nn1.
What is the InChIKey of N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine?
The InChIKey is WPSJYXMPHSCEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN5/c1-4-14-7-10-5-6-11(16-15-10)18-9(3)12(13)8(2)17-18/h5-6,14H,4,7H2,1-3H3.
What are the key properties of N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine?
N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine has a molecular weight of 265.75 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(4-chloro-3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]methyl]ethanamine is sourced from PubChem (CID 62293226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).