About N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine
N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 62293326) has the molecular formula C16H26ClN3O
and a molecular weight of 311.86 g/mol. Its IUPAC name is N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 62293326 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cnc(N2CCOCC2(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H26ClN3O/c1-15(2,3)19-10-12-8-13(17)14(18-9-12)20-6-7-21-11-16(20,4)5/h8-9,19H,6-7,10-11H2,1-5H3 |
| InChIKey | IHQAICQCYXWSCI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine (CID 62293326) is N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine is CC(C)(C)NCc1cnc(N2CCOCC2(C)C)c(Cl)c1.
What is the InChIKey of N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
The InChIKey is IHQAICQCYXWSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26ClN3O/c1-15(2,3)19-10-12-8-13(17)14(18-9-12)20-6-7-21-11-16(20,4)5/h8-9,19H,6-7,10-11H2,1-5H3.
What are the key properties of N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine has a molecular weight of 311.86 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-chloro-6-(3,3-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 62293326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).