C15H26ClN3O2 — CID 62295520
3-chloro-5-(ethylaminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridin-2-amine (PubChem CID 62295520) has the molecular formula C15H26ClN3O2 and a molecular weight of 315.85 g/mol. Its IUPAC name is 3-chloro-5-(ethylaminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridin-2-amine.
| Compound Name | 3-chloro-5-(ethylaminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62295520 |
| Molecular Formula | C15H26ClN3O2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 3-chloro-5-(ethylaminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridin-2-amine |
| SMILES | CCNCc1cnc(N(CCCOC)CCOC)c(Cl)c1 |
| InChI | InChI=1S/C15H26ClN3O2/c1-4-17-11-13-10-14(16)15(18-12-13)19(7-9-21-3)6-5-8-20-2/h10,12,17H,4-9,11H2,1-3H3 |
| InChIKey | WNIJTIJZVBUMPK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|