C14H15ClFN3O — CID 62295801
[5-(2-chloro-4-fluorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanamine (PubChem CID 62295801) has the molecular formula C14H15ClFN3O and a molecular weight of 295.75 g/mol. Its IUPAC name is [5-(2-chloro-4-fluorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanamine.
| Compound Name | [5-(2-chloro-4-fluorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanamine |
|---|---|
| PubChem CID | 62295801 |
| Molecular Formula | C14H15ClFN3O |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [5-(2-chloro-4-fluorophenoxy)-2-propan-2-ylpyrimidin-4-yl]methanamine |
| SMILES | CC(C)c1ncc(Oc2ccc(F)cc2Cl)c(CN)n1 |
| InChI | InChI=1S/C14H15ClFN3O/c1-8(2)14-18-7-13(11(6-17)19-14)20-12-4-3-9(16)5-10(12)15/h3-5,7-8H,6,17H2,1-2H3 |
| InChIKey | KFRCNJIIVOHWFN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |