C14H24N2O — CID 62296147
1-(4,6-dimethyl-2-pentoxy-3-pyridinyl)-N-methylmethanamine (PubChem CID 62296147) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pentoxy-3-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-(4,6-dimethyl-2-pentoxy-3-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 62296147 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(4,6-dimethyl-2-pentoxy-3-pyridinyl)-N-methylmethanamine |
| SMILES | CCCCCOc1nc(C)cc(C)c1CNC |
| InChI | InChI=1S/C14H24N2O/c1-5-6-7-8-17-14-13(10-15-4)11(2)9-12(3)16-14/h9,15H,5-8,10H2,1-4H3 |
| InChIKey | NAKNQULKEPHORP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|