C14H14Cl2N2O — CID 62297790
N-[[2-(2,5-dichlorophenoxy)-4-pyridinyl]methyl]ethanamine (PubChem CID 62297790) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is N-[[2-(2,5-dichlorophenoxy)-4-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[2-(2,5-dichlorophenoxy)-4-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62297790 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-[[2-(2,5-dichlorophenoxy)-4-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1ccnc(Oc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O/c1-2-17-9-10-5-6-18-14(7-10)19-13-8-11(15)3-4-12(13)16/h3-8,17H,2,9H2,1H3 |
| InChIKey | MJFGDOFLCRRDNZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |