C15H16Cl2N2O — CID 62298107
N-[[2-(2,3-dichlorophenoxy)-4-pyridinyl]methyl]propan-2-amine (PubChem CID 62298107) has the molecular formula C15H16Cl2N2O and a molecular weight of 311.21 g/mol. Its IUPAC name is N-[[2-(2,3-dichlorophenoxy)-4-pyridinyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(2,3-dichlorophenoxy)-4-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62298107 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[[2-(2,3-dichlorophenoxy)-4-pyridinyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccnc(Oc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-10(2)19-9-11-6-7-18-14(8-11)20-13-5-3-4-12(16)15(13)17/h3-8,10,19H,9H2,1-2H3 |
| InChIKey | SEUTUTUMBOPBTM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |