C33H32O7 — CID 622983
3-methoxy-2,3,5,6-tetrakis(4-methoxyphenyl)-2H-1,4-dioxine (PubChem CID 622983) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is 3-methoxy-2,3,5,6-tetrakis(4-methoxyphenyl)-2H-1,4-dioxine.
| Compound Name | 3-methoxy-2,3,5,6-tetrakis(4-methoxyphenyl)-2H-1,4-dioxine |
|---|---|
| PubChem CID | 622983 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 3-methoxy-2,3,5,6-tetrakis(4-methoxyphenyl)-2H-1,4-dioxine |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)OC(OC)(c3ccc(OC)cc3)C(c3ccc(OC)cc3)O2)cc1 |
| InChI | InChI=1S/C33H32O7/c1-34-26-14-6-22(7-15-26)30-31(23-8-16-27(35-2)17-9-23)40-33(38-5,25-12-20-29(37-4)21-13-25)32(39-30)24-10-18-28(36-3)19-11-24/h6-21,32H,1-5H3 |
| InChIKey | WELXPPMNSRKBGH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|