About 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid
5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid (PubChem CID 62298877) has the molecular formula C12H12F2O3S
and a molecular weight of 274.29 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid |
| PubChem CID | 62298877 |
| Molecular Formula | C12H12F2O3S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(CSc2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C12H12F2O3S/c13-9-3-2-8(5-10(9)14)18-6-7-1-4-11(17-7)12(15)16/h2-3,5,7,11H,1,4,6H2,(H,15,16) |
| InChIKey | IPGZERNZKAXGJW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid (CID 62298877) is 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid is O=C(O)C1CCC(CSc2ccc(F)c(F)c2)O1.
What is the InChIKey of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
The InChIKey is IPGZERNZKAXGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O3S/c13-9-3-2-8(5-10(9)14)18-6-7-1-4-11(17-7)12(15)16/h2-3,5,7,11H,1,4,6H2,(H,15,16).
What are the key properties of 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid has a molecular weight of 274.29 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 62298877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).