C13H12N4O2 — CID 62298914
N-[3-(cyanomethoxy)phenyl]-2-methylpyrazole-3-carboxamide (PubChem CID 62298914) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-[3-(cyanomethoxy)phenyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-(cyanomethoxy)phenyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62298914 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-[3-(cyanomethoxy)phenyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1cccc(OCC#N)c1 |
| InChI | InChI=1S/C13H12N4O2/c1-17-12(5-7-15-17)13(18)16-10-3-2-4-11(9-10)19-8-6-14/h2-5,7,9H,8H2,1H3,(H,16,18) |
| InChIKey | YHTQZZAMYYBLQD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |