5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid

C12H12F2O3S — CID 62299047

IUPAC5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid
SMILESO=C(O)C1CCC(CSc2cc(F)ccc2F)O1
InChIInChI=1S/C12H12F2O3S/c13-7-1-3-9(14)11(5-7)18-6-8-2-4-10(17-8)12(15)16/h1,3,5,8,10H,2,4,6H2,(H,15,16)
InChIKeyQOPHZEUZIGSXOD-UHFFFAOYSA-N
MW274.29 g/mol
LogP2.69
Rot. Bonds4

About 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid

5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid (PubChem CID 62299047) has the molecular formula C12H12F2O3S and a molecular weight of 274.29 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid.

Molecular Properties

Compound Name5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid
PubChem CID62299047
Molecular FormulaC12H12F2O3S
Molecular Weight274.29 g/mol
Exact Mass274.05
IUPAC Name5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid
SMILESO=C(O)C1CCC(CSc2cc(F)ccc2F)O1
InChIInChI=1S/C12H12F2O3S/c13-7-1-3-9(14)11(5-7)18-6-8-2-4-10(17-8)12(15)16/h1,3,5,8,10H,2,4,6H2,(H,15,16)
InChIKeyQOPHZEUZIGSXOD-UHFFFAOYSA-N
XLogP2.69
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.29
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
The IUPAC name of 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid (CID 62299047) is 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid.
What is the SMILES notation for 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
The canonical SMILES for 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid is O=C(O)C1CCC(CSc2cc(F)ccc2F)O1.
What is the InChIKey of 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
The InChIKey is QOPHZEUZIGSXOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O3S/c13-7-1-3-9(14)11(5-7)18-6-8-2-4-10(17-8)12(15)16/h1,3,5,8,10H,2,4,6H2,(H,15,16).
What are the key properties of 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid?
5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid has a molecular weight of 274.29 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-difluorophenyl)sulfanylmethyl]oxolane-2-carboxylic acid is sourced from PubChem (CID 62299047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).