About 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine
6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine (PubChem CID 62299091) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine |
| PubChem CID | 62299091 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine |
| SMILES | C=CCN(CC=C)c1cccc(CN)n1 |
| InChI | InChI=1S/C12H17N3/c1-3-8-15(9-4-2)12-7-5-6-11(10-13)14-12/h3-7H,1-2,8-10,13H2 |
| InChIKey | LDCILINAYNRIHB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine?
The IUPAC name of 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine (CID 62299091) is 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine.
What is the SMILES notation for 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine?
The canonical SMILES for 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine is C=CCN(CC=C)c1cccc(CN)n1.
What is the InChIKey of 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine?
The InChIKey is LDCILINAYNRIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-3-8-15(9-4-2)12-7-5-6-11(10-13)14-12/h3-7H,1-2,8-10,13H2.
What are the key properties of 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine?
6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine has a molecular weight of 203.29 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-N,N-bis(prop-2-enyl)pyridin-2-amine is sourced from PubChem (CID 62299091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).