About 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine
6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine (PubChem CID 62299273) has the molecular formula C10H16ClN3
and a molecular weight of 213.71 g/mol. Its IUPAC name is 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine |
| PubChem CID | 62299273 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine |
| SMILES | CCN(CC)c1ccc(Cl)c(CN)n1 |
| InChI | InChI=1S/C10H16ClN3/c1-3-14(4-2)10-6-5-8(11)9(7-12)13-10/h5-6H,3-4,7,12H2,1-2H3 |
| InChIKey | LNNCPOVKZUXGAS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine?
The IUPAC name of 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine (CID 62299273) is 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine.
What is the SMILES notation for 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine?
The canonical SMILES for 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine is CCN(CC)c1ccc(Cl)c(CN)n1.
What is the InChIKey of 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine?
The InChIKey is LNNCPOVKZUXGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3/c1-3-14(4-2)10-6-5-8(11)9(7-12)13-10/h5-6H,3-4,7,12H2,1-2H3.
What are the key properties of 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine?
6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine has a molecular weight of 213.71 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-5-chloro-N,N-diethylpyridin-2-amine is sourced from PubChem (CID 62299273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).