C15H20FNO4 — CID 62300639
5-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]oxolane-2-carboxylic acid (PubChem CID 62300639) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is 5-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62300639 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 5-[[(3-fluoro-4-methoxyphenyl)methyl-methylamino]methyl]oxolane-2-carboxylic acid |
| SMILES | COc1ccc(CN(C)CC2CCC(C(=O)O)O2)cc1F |
| InChI | InChI=1S/C15H20FNO4/c1-17(9-11-4-6-14(21-11)15(18)19)8-10-3-5-13(20-2)12(16)7-10/h3,5,7,11,14H,4,6,8-9H2,1-2H3,(H,18,19) |
| InChIKey | AHFRAWCBCDNWCG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |