C10H16N2O4 — CID 62301232
1-(4-amino-4-oxobutyl)-6-oxopiperidine-3-carboxylic acid (PubChem CID 62301232) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-(4-amino-4-oxobutyl)-6-oxopiperidine-3-carboxylic acid.
| Compound Name | 1-(4-amino-4-oxobutyl)-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 62301232 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-(4-amino-4-oxobutyl)-6-oxopiperidine-3-carboxylic acid |
| SMILES | NC(=O)CCCN1CC(C(=O)O)CCC1=O |
| InChI | InChI=1S/C10H16N2O4/c11-8(13)2-1-5-12-6-7(10(15)16)3-4-9(12)14/h7H,1-6H2,(H2,11,13)(H,15,16) |
| InChIKey | NEMGWQWSJBWLAX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |