C33H28N2O5 — CID 6230351
(E)-[4,5-dioxo-2-(3-phenylmethoxyphenyl)-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate (PubChem CID 6230351) has the molecular formula C33H28N2O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is (E)-[4,5-dioxo-2-(3-phenylmethoxyphenyl)-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate.
| Compound Name | (E)-[4,5-dioxo-2-(3-phenylmethoxyphenyl)-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
|---|---|
| PubChem CID | 6230351 |
| Molecular Formula | C33H28N2O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (E)-[4,5-dioxo-2-(3-phenylmethoxyphenyl)-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
| SMILES | CC1Cc2cc(/C([O-])=C3\C(=O)C(=O)N(Cc4cc[nH+]cc4)C3c3cccc(OCc4ccccc4)c3)ccc2O1 |
| InChI | InChI=1S/C33H28N2O5/c1-21-16-26-17-25(10-11-28(26)40-21)31(36)29-30(35(33(38)32(29)37)19-22-12-14-34-15-13-22)24-8-5-9-27(18-24)39-20-23-6-3-2-4-7-23/h2-15,17-18,21,30,36H,16,19-20H2,1H3/b31-29+ |
| InChIKey | INPOPVAHNSDVKQ-OWWNRXNESA-N |
| XLogP | 3.83 |
| TPSA | 93.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|