2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid

C13H13N3O2S — CID 62303956

IUPAC2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid
SMILESCc1cc(C)nc(Sc2ccc(N)c(C(=O)O)c2)n1
InChIInChI=1S/C13H13N3O2S/c1-7-5-8(2)16-13(15-7)19-9-3-4-11(14)10(6-9)12(17)18/h3-6H,14H2,1-2H3,(H,17,18)
InChIKeyQOVCBGPRWNKPEW-UHFFFAOYSA-N
MW275.33 g/mol
LogP2.53
Rot. Bonds3

About 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid

2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid (PubChem CID 62303956) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid.

Molecular Properties

Compound Name2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid
PubChem CID62303956
Molecular FormulaC13H13N3O2S
Molecular Weight275.33 g/mol
Exact Mass275.07
IUPAC Name2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid
SMILESCc1cc(C)nc(Sc2ccc(N)c(C(=O)O)c2)n1
InChIInChI=1S/C13H13N3O2S/c1-7-5-8(2)16-13(15-7)19-9-3-4-11(14)10(6-9)12(17)18/h3-6H,14H2,1-2H3,(H,17,18)
InChIKeyQOVCBGPRWNKPEW-UHFFFAOYSA-N
XLogP2.53
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.33
LogP ≤ 52.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid?
The IUPAC name of 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid (CID 62303956) is 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid.
What is the SMILES notation for 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid?
The canonical SMILES for 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid is Cc1cc(C)nc(Sc2ccc(N)c(C(=O)O)c2)n1.
What is the InChIKey of 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid?
The InChIKey is QOVCBGPRWNKPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2S/c1-7-5-8(2)16-13(15-7)19-9-3-4-11(14)10(6-9)12(17)18/h3-6H,14H2,1-2H3,(H,17,18).
What are the key properties of 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid?
2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid has a molecular weight of 275.33 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(4,6-dimethylpyrimidin-2-yl)sulfanylbenzoic acid is sourced from PubChem (CID 62303956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).