C18H20N2S — CID 62304214
5-phenyl-N-(1-phenylpropyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 62304214) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 5-phenyl-N-(1-phenylpropyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-phenyl-N-(1-phenylpropyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62304214 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 5-phenyl-N-(1-phenylpropyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC(NC1=NCC(c2ccccc2)S1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2S/c1-2-16(14-9-5-3-6-10-14)20-18-19-13-17(21-18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3,(H,19,20) |
| InChIKey | XNSUTTKYVOWWMU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |