C19H22FN — CID 62304356
3-(3-fluorophenyl)-N-(1-phenylpropyl)cyclobutan-1-amine (PubChem CID 62304356) has the molecular formula C19H22FN and a molecular weight of 283.39 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(1-phenylpropyl)cyclobutan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-N-(1-phenylpropyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 62304356 |
| Molecular Formula | C19H22FN |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(1-phenylpropyl)cyclobutan-1-amine |
| SMILES | CCC(NC1CC(c2cccc(F)c2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H22FN/c1-2-19(14-7-4-3-5-8-14)21-18-12-16(13-18)15-9-6-10-17(20)11-15/h3-11,16,18-19,21H,2,12-13H2,1H3 |
| InChIKey | SNBYNFGOAHVCCJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |