About 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid
6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid (PubChem CID 62304478) has the molecular formula C15H25N3O2S
and a molecular weight of 311.45 g/mol. Its IUPAC name is 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid.
Molecular Properties
| Compound Name | 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid |
| PubChem CID | 62304478 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid |
| SMILES | CCNC(C)(CCCCSc1nc(C)cc(C)n1)C(=O)O |
| InChI | InChI=1S/C15H25N3O2S/c1-5-16-15(4,13(19)20)8-6-7-9-21-14-17-11(2)10-12(3)18-14/h10,16H,5-9H2,1-4H3,(H,19,20) |
| InChIKey | SZGGBHDGLRADHL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid?
The IUPAC name of 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid (CID 62304478) is 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid.
What is the SMILES notation for 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid?
The canonical SMILES for 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid is CCNC(C)(CCCCSc1nc(C)cc(C)n1)C(=O)O.
What is the InChIKey of 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid?
The InChIKey is SZGGBHDGLRADHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2S/c1-5-16-15(4,13(19)20)8-6-7-9-21-14-17-11(2)10-12(3)18-14/h10,16H,5-9H2,1-4H3,(H,19,20).
What are the key properties of 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid?
6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid has a molecular weight of 311.45 g/mol, XLogP of 2.81, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(ethylamino)-2-methylhexanoic acid is sourced from PubChem (CID 62304478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).