C14H23N3O2S — CID 62304479
methyl 2-amino-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylhexanoate (PubChem CID 62304479) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is methyl 2-amino-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylhexanoate.
| Compound Name | methyl 2-amino-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylhexanoate |
|---|---|
| PubChem CID | 62304479 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | methyl 2-amino-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-methylhexanoate |
| SMILES | COC(=O)C(C)(N)CCCCSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H23N3O2S/c1-10-9-11(2)17-13(16-10)20-8-6-5-7-14(3,15)12(18)19-4/h9H,5-8,15H2,1-4H3 |
| InChIKey | CDWBVNGSQXOALZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|