C17H19N3S — CID 62304603
6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-ylamino)pyridine-3-carbothioamide (PubChem CID 62304603) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-ylamino)pyridine-3-carbothioamide.
| Compound Name | 6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-ylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 62304603 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 6-methyl-2-(1,2,3,4-tetrahydronaphthalen-2-ylamino)pyridine-3-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(NC2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C17H19N3S/c1-11-6-9-15(16(18)21)17(19-11)20-14-8-7-12-4-2-3-5-13(12)10-14/h2-6,9,14H,7-8,10H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | IFYMABCOOXIKJQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|