C27H34N2O7 — CID 6230477
(E)-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(4-propoxyphenyl)methanolate (PubChem CID 6230477) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is (E)-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(4-propoxyphenyl)methanolate.
| Compound Name | (E)-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(4-propoxyphenyl)methanolate |
|---|---|
| PubChem CID | 6230477 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (E)-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-(3,4,5-trimethoxyphenyl)pyrrolidin-3-ylidene]-(4-propoxyphenyl)methanolate |
| SMILES | CCCOc1ccc(/C([O-])=C2\C(=O)C(=O)N(CC[NH+](C)C)C2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H34N2O7/c1-7-14-36-19-10-8-17(9-11-19)24(30)22-23(29(13-12-28(2)3)27(32)25(22)31)18-15-20(33-4)26(35-6)21(16-18)34-5/h8-11,15-16,23,30H,7,12-14H2,1-6H3/b24-22+ |
| InChIKey | UXTLKAUJNBNMJF-ZNTNEXAZSA-N |
| XLogP | 0.87 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|