C12H19N3S — CID 62305322
4,6-dimethyl-2-(piperidin-3-ylmethylsulfanyl)pyrimidine (PubChem CID 62305322) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 4,6-dimethyl-2-(piperidin-3-ylmethylsulfanyl)pyrimidine.
| Compound Name | 4,6-dimethyl-2-(piperidin-3-ylmethylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 62305322 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4,6-dimethyl-2-(piperidin-3-ylmethylsulfanyl)pyrimidine |
| SMILES | Cc1cc(C)nc(SCC2CCCNC2)n1 |
| InChI | InChI=1S/C12H19N3S/c1-9-6-10(2)15-12(14-9)16-8-11-4-3-5-13-7-11/h6,11,13H,3-5,7-8H2,1-2H3 |
| InChIKey | OSZWGFGPMDRMPB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |