C9H10N2O3 — CID 62306859
2-[(6-methyl-2-pyridinyl)methylamino]-2-oxoacetic acid (PubChem CID 62306859) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[(6-methyl-2-pyridinyl)methylamino]-2-oxoacetic acid.
| Compound Name | 2-[(6-methyl-2-pyridinyl)methylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 62306859 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-[(6-methyl-2-pyridinyl)methylamino]-2-oxoacetic acid |
| SMILES | Cc1cccc(CNC(=O)C(=O)O)n1 |
| InChI | InChI=1S/C9H10N2O3/c1-6-3-2-4-7(11-6)5-10-8(12)9(13)14/h2-4H,5H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | HUYAMLKSMRXQLS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|