About 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid
1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid (PubChem CID 62309566) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid |
| PubChem CID | 62309566 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid |
| SMILES | CC#CCn1c(C)c(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C15H15NO2/c1-4-5-8-16-11(3)10(2)13-9-12(15(17)18)6-7-14(13)16/h6-7,9H,8H2,1-3H3,(H,17,18) |
| InChIKey | KESOWHWLDSHJDH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid?
The IUPAC name of 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid (CID 62309566) is 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid.
What is the SMILES notation for 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid?
The canonical SMILES for 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid is CC#CCn1c(C)c(C)c2cc(C(=O)O)ccc21.
What is the InChIKey of 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid?
The InChIKey is KESOWHWLDSHJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-4-5-8-16-11(3)10(2)13-9-12(15(17)18)6-7-14(13)16/h6-7,9H,8H2,1-3H3,(H,17,18).
What are the key properties of 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid?
1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid has a molecular weight of 241.29 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-ynyl-2,3-dimethylindole-5-carboxylic acid is sourced from PubChem (CID 62309566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).