About 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol
7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 62312344) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| PubChem CID | 62312344 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CC#CCOc1ccc2c(c1)OC(C)(C)CC2O |
| InChI | InChI=1S/C15H18O3/c1-4-5-8-17-11-6-7-12-13(16)10-15(2,3)18-14(12)9-11/h6-7,9,13,16H,8,10H2,1-3H3 |
| InChIKey | UQXBMOVAFQRHHO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The IUPAC name of 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol (CID 62312344) is 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol is CC#CCOc1ccc2c(c1)OC(C)(C)CC2O.
What is the InChIKey of 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The InChIKey is UQXBMOVAFQRHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-4-5-8-17-11-6-7-12-13(16)10-15(2,3)18-14(12)9-11/h6-7,9,13,16H,8,10H2,1-3H3.
What are the key properties of 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol?
7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol has a molecular weight of 246.31 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-but-2-ynoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 62312344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).