C12H17N3O — CID 62312577
2-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 62312577) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 62312577 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Nc1nc(C2CCOC2)nc2c1CCCC2 |
| InChI | InChI=1S/C12H17N3O/c13-11-9-3-1-2-4-10(9)14-12(15-11)8-5-6-16-7-8/h8H,1-7H2,(H2,13,14,15) |
| InChIKey | CLVOQVKMDIXPGA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |