About N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine
N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine (PubChem CID 62313283) has the molecular formula C16H17F3N2
and a molecular weight of 294.32 g/mol. Its IUPAC name is N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine |
| PubChem CID | 62313283 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine |
| SMILES | NCCCN(c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2/c17-16(18,19)14-9-4-5-10-15(14)21(12-6-11-20)13-7-2-1-3-8-13/h1-5,7-10H,6,11-12,20H2 |
| InChIKey | SCIYRAXGTLGRQG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine?
The IUPAC name of N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine (CID 62313283) is N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine.
What is the SMILES notation for N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine?
The canonical SMILES for N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine is NCCCN(c1ccccc1)c1ccccc1C(F)(F)F.
What is the InChIKey of N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine?
The InChIKey is SCIYRAXGTLGRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3N2/c17-16(18,19)14-9-4-5-10-15(14)21(12-6-11-20)13-7-2-1-3-8-13/h1-5,7-10H,6,11-12,20H2.
What are the key properties of N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine?
N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine has a molecular weight of 294.32 g/mol, XLogP of 4.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-phenyl-N'-[2-(trifluoromethyl)phenyl]propane-1,3-diamine is sourced from PubChem (CID 62313283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).