C13H18Cl2N2 — CID 62313670
4-N-[(3,4-dichlorophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 62313670) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 4-N-[(3,4-dichlorophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(3,4-dichlorophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62313670 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-N-[(3,4-dichlorophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18Cl2N2/c14-12-6-1-9(7-13(12)15)8-17-11-4-2-10(16)3-5-11/h1,6-7,10-11,17H,2-5,8,16H2 |
| InChIKey | HXZQHBSGGVCHDI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |