About 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine
4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine (PubChem CID 62314218) has the molecular formula C14H20F2N2
and a molecular weight of 254.32 g/mol. Its IUPAC name is 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine |
| PubChem CID | 62314218 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine |
| SMILES | CC(NC1CCC(N)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H20F2N2/c1-9(14-12(15)3-2-4-13(14)16)18-11-7-5-10(17)6-8-11/h2-4,9-11,18H,5-8,17H2,1H3 |
| InChIKey | VKEXRPVLRHATNN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine?
The IUPAC name of 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine (CID 62314218) is 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine.
What is the SMILES notation for 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine?
The canonical SMILES for 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine is CC(NC1CCC(N)CC1)c1c(F)cccc1F.
What is the InChIKey of 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine?
The InChIKey is VKEXRPVLRHATNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2/c1-9(14-12(15)3-2-4-13(14)16)18-11-7-5-10(17)6-8-11/h2-4,9-11,18H,5-8,17H2,1H3.
What are the key properties of 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine?
4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine has a molecular weight of 254.32 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[1-(2,6-difluorophenyl)ethyl]cyclohexane-1,4-diamine is sourced from PubChem (CID 62314218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).