C11H17BrN2S — CID 62314221
4-N-[(5-bromothiophen-2-yl)methyl]cyclohexane-1,4-diamine (PubChem CID 62314221) has the molecular formula C11H17BrN2S and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-N-[(5-bromothiophen-2-yl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(5-bromothiophen-2-yl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62314221 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 4-N-[(5-bromothiophen-2-yl)methyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C11H17BrN2S/c12-11-6-5-10(15-11)7-14-9-3-1-8(13)2-4-9/h5-6,8-9,14H,1-4,7,13H2 |
| InChIKey | OPODQOAPFUVANV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |